C19H19ClN3OS+ — CID 5088195
4-(4-chlorophenyl)-2-hydroxy-2-methyl-3-(3-methylpyridin-1-ium-1-yl)-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 5088195) has the molecular formula C19H19ClN3OS+ and a molecular weight of 372.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-hydroxy-2-methyl-3-(3-methylpyridin-1-ium-1-yl)-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | 4-(4-chlorophenyl)-2-hydroxy-2-methyl-3-(3-methylpyridin-1-ium-1-yl)-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 5088195 |
| Molecular Formula | C19H19ClN3OS+ |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 4-(4-chlorophenyl)-2-hydroxy-2-methyl-3-(3-methylpyridin-1-ium-1-yl)-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | Cc1ccc[n+](C2C(c3ccc(Cl)cc3)C(C#N)=C(S)NC2(C)O)c1 |
| InChI | InChI=1S/C19H18ClN3OS/c1-12-4-3-9-23(11-12)17-16(13-5-7-14(20)8-6-13)15(10-21)18(25)22-19(17,2)24/h3-9,11,16-17,22,24H,1-2H3/p+1 |
| InChIKey | ZRMGVQTZOSWLOV-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|