C31H30Cl2N3OS+ — CID 98500723
(2S,3S,4R)-2-(1-adamantyl)-4-(3,4-dichlorophenyl)-2-hydroxy-3-isoquinolin-2-ium-2-yl-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 98500723) has the molecular formula C31H30Cl2N3OS+ and a molecular weight of 563.57 g/mol. Its IUPAC name is (2S,3S,4R)-2-(1-adamantyl)-4-(3,4-dichlorophenyl)-2-hydroxy-3-isoquinolin-2-ium-2-yl-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | (2S,3S,4R)-2-(1-adamantyl)-4-(3,4-dichlorophenyl)-2-hydroxy-3-isoquinolin-2-ium-2-yl-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 98500723 |
| Molecular Formula | C31H30Cl2N3OS+ |
| Molecular Weight | 563.57 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | (2S,3S,4R)-2-(1-adamantyl)-4-(3,4-dichlorophenyl)-2-hydroxy-3-isoquinolin-2-ium-2-yl-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | N#CC1=C(S)N[C@](O)(C23CC4CC(CC(C4)C2)C3)[C@@H]([n+]2ccc3ccccc3c2)[C@@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C31H29Cl2N3OS/c32-25-6-5-22(12-26(25)33)27-24(16-34)29(38)35-31(37,30-13-18-9-19(14-30)11-20(10-18)15-30)28(27)36-8-7-21-3-1-2-4-23(21)17-36/h1-8,12,17-20,27-28,35,37H,9-11,13-15H2/p+1/t18?,19?,20?,27-,28+,30?,31-/m1/s1 |
| InChIKey | UETOMYZMPXKZIT-LJYNQRATSA-O |
| XLogP | 6.93 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.57 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|