C31H31BrN3OS+ — CID 176523786
6-(1-adamantyl)-4-(3-bromophenyl)-6-hydroxy-3-(iminomethylidene)-5-isoquinolin-2-ium-2-ylpiperidine-2-thione (PubChem CID 176523786) has the molecular formula C31H31BrN3OS+ and a molecular weight of 573.58 g/mol. Its IUPAC name is 6-(1-adamantyl)-4-(3-bromophenyl)-6-hydroxy-3-(iminomethylidene)-5-isoquinolin-2-ium-2-ylpiperidine-2-thione.
| Compound Name | 6-(1-adamantyl)-4-(3-bromophenyl)-6-hydroxy-3-(iminomethylidene)-5-isoquinolin-2-ium-2-ylpiperidine-2-thione |
|---|---|
| PubChem CID | 176523786 |
| Molecular Formula | C31H31BrN3OS+ |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 6-(1-adamantyl)-4-(3-bromophenyl)-6-hydroxy-3-(iminomethylidene)-5-isoquinolin-2-ium-2-ylpiperidine-2-thione |
| SMILES | N=C=C1C(=S)NC(O)(C23CC4CC(CC(C4)C2)C3)C([n+]2ccc3ccccc3c2)C1c1cccc(Br)c1 |
| InChI | InChI=1S/C31H30BrN3OS/c32-25-7-3-6-23(13-25)27-26(17-33)29(37)34-31(36,30-14-19-10-20(15-30)12-21(11-19)16-30)28(27)35-9-8-22-4-1-2-5-24(22)18-35/h1-9,13,18-21,27-28,33,36H,10-12,14-16H2/p+1 |
| InChIKey | XYAYSTJLGFTORR-UHFFFAOYSA-O |
| XLogP | 6.23 |
| TPSA | 59.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|