C17H14N3OS2+ — CID 176543267
(4R,5S)-4-(4-hydroxyphenyl)-3-(iminomethylidene)-5-pyridin-1-ium-1-ylpiperidine-2,6-dithione (PubChem CID 176543267) has the molecular formula C17H14N3OS2+ and a molecular weight of 340.45 g/mol. Its IUPAC name is (4R,5S)-4-(4-hydroxyphenyl)-3-(iminomethylidene)-5-pyridin-1-ium-1-ylpiperidine-2,6-dithione.
| Compound Name | (4R,5S)-4-(4-hydroxyphenyl)-3-(iminomethylidene)-5-pyridin-1-ium-1-ylpiperidine-2,6-dithione |
|---|---|
| PubChem CID | 176543267 |
| Molecular Formula | C17H14N3OS2+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (4R,5S)-4-(4-hydroxyphenyl)-3-(iminomethylidene)-5-pyridin-1-ium-1-ylpiperidine-2,6-dithione |
| SMILES | N=C=C1C(=S)NC(=S)[C@@H]([n+]2ccccc2)[C@@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C17H13N3OS2/c18-10-13-14(11-4-6-12(21)7-5-11)15(17(23)19-16(13)22)20-8-2-1-3-9-20/h1-9,14-15,18H,(H-,19,21,22,23)/p+1/t14-,15+/m1/s1 |
| InChIKey | SVFRKFCWWJYUDW-CABCVRRESA-O |
| XLogP | 2.44 |
| TPSA | 59.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|