C16H16N3OS2+ — CID 176529223
(4S,5R,6R)-6-hydroxy-3-(iminomethylidene)-6-methyl-5-pyridin-1-ium-1-yl-4-thiophen-3-ylpiperidine-2-thione (PubChem CID 176529223) has the molecular formula C16H16N3OS2+ and a molecular weight of 330.46 g/mol. Its IUPAC name is (4S,5R,6R)-6-hydroxy-3-(iminomethylidene)-6-methyl-5-pyridin-1-ium-1-yl-4-thiophen-3-ylpiperidine-2-thione.
| Compound Name | (4S,5R,6R)-6-hydroxy-3-(iminomethylidene)-6-methyl-5-pyridin-1-ium-1-yl-4-thiophen-3-ylpiperidine-2-thione |
|---|---|
| PubChem CID | 176529223 |
| Molecular Formula | C16H16N3OS2+ |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (4S,5R,6R)-6-hydroxy-3-(iminomethylidene)-6-methyl-5-pyridin-1-ium-1-yl-4-thiophen-3-ylpiperidine-2-thione |
| SMILES | C[C@]1(O)NC(=S)C(=C=N)[C@H](c2ccsc2)[C@H]1[n+]1ccccc1 |
| InChI | InChI=1S/C16H15N3OS2/c1-16(20)14(19-6-3-2-4-7-19)13(11-5-8-22-10-11)12(9-17)15(21)18-16/h2-8,10,13-14,17,20H,1H3/p+1/t13-,14+,16+/m0/s1 |
| InChIKey | KZFNOVXSRFLLLF-SQWLQELKSA-O |
| XLogP | 2.17 |
| TPSA | 59.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|