C17H13BrN3OS+ — CID 176522848
(3R,4S)-4-(4-bromophenyl)-5-(iminomethylidene)-3-pyridin-1-ium-1-yl-6-sulfanylidenepiperidin-2-one (PubChem CID 176522848) has the molecular formula C17H13BrN3OS+ and a molecular weight of 387.28 g/mol. Its IUPAC name is (3R,4S)-4-(4-bromophenyl)-5-(iminomethylidene)-3-pyridin-1-ium-1-yl-6-sulfanylidenepiperidin-2-one.
| Compound Name | (3R,4S)-4-(4-bromophenyl)-5-(iminomethylidene)-3-pyridin-1-ium-1-yl-6-sulfanylidenepiperidin-2-one |
|---|---|
| PubChem CID | 176522848 |
| Molecular Formula | C17H13BrN3OS+ |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | (3R,4S)-4-(4-bromophenyl)-5-(iminomethylidene)-3-pyridin-1-ium-1-yl-6-sulfanylidenepiperidin-2-one |
| SMILES | N=C=C1C(=S)NC(=O)[C@H]([n+]2ccccc2)[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H12BrN3OS/c18-12-6-4-11(5-7-12)14-13(10-19)17(23)20-16(22)15(14)21-8-2-1-3-9-21/h1-9,14-15,19H/p+1/t14-,15+/m0/s1 |
| InChIKey | JQXZIJPYECJZON-LSDHHAIUSA-O |
| XLogP | 2.69 |
| TPSA | 56.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|