C18H14N5O5S+ — CID 176516776
4-(2,4-dinitrophenyl)-5-(iminomethylidene)-3-(3-methylpyridin-1-ium-1-yl)-6-sulfanylidenepiperidin-2-one (PubChem CID 176516776) has the molecular formula C18H14N5O5S+ and a molecular weight of 412.41 g/mol. Its IUPAC name is 4-(2,4-dinitrophenyl)-5-(iminomethylidene)-3-(3-methylpyridin-1-ium-1-yl)-6-sulfanylidenepiperidin-2-one.
| Compound Name | 4-(2,4-dinitrophenyl)-5-(iminomethylidene)-3-(3-methylpyridin-1-ium-1-yl)-6-sulfanylidenepiperidin-2-one |
|---|---|
| PubChem CID | 176516776 |
| Molecular Formula | C18H14N5O5S+ |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 4-(2,4-dinitrophenyl)-5-(iminomethylidene)-3-(3-methylpyridin-1-ium-1-yl)-6-sulfanylidenepiperidin-2-one |
| SMILES | Cc1ccc[n+](C2C(=O)NC(=S)C(=C=N)C2c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13N5O5S/c1-10-3-2-6-21(9-10)16-15(13(8-19)18(29)20-17(16)24)12-5-4-11(22(25)26)7-14(12)23(27)28/h2-7,9,15-16,19H,1H3/p+1 |
| InChIKey | CVOHSDWVCQZTCW-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|