C17H16N4O2+2 — CID 176522837
(4S,5R)-3-(iminomethylidene)-4-(1-methylpyridin-1-ium-3-yl)-5-pyridin-1-ium-1-ylpiperidine-2,6-dione (PubChem CID 176522837) has the molecular formula C17H16N4O2+2 and a molecular weight of 308.34 g/mol. Its IUPAC name is (4S,5R)-3-(iminomethylidene)-4-(1-methylpyridin-1-ium-3-yl)-5-pyridin-1-ium-1-ylpiperidine-2,6-dione.
| Compound Name | (4S,5R)-3-(iminomethylidene)-4-(1-methylpyridin-1-ium-3-yl)-5-pyridin-1-ium-1-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 176522837 |
| Molecular Formula | C17H16N4O2+2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (4S,5R)-3-(iminomethylidene)-4-(1-methylpyridin-1-ium-3-yl)-5-pyridin-1-ium-1-ylpiperidine-2,6-dione |
| SMILES | C[n+]1cccc([C@H]2C(=C=N)C(=O)NC(=O)[C@@H]2[n+]2ccccc2)c1 |
| InChI | InChI=1S/C17H15N4O2/c1-20-7-5-6-12(11-20)14-13(10-18)16(22)19-17(23)15(14)21-8-3-2-4-9-21/h2-9,11,14-15,18H,1H3/q+1/p+1/t14-,15+/m0/s1 |
| InChIKey | SAVFSINPEYFJBS-LSDHHAIUSA-O |
| XLogP | -0.05 |
| TPSA | 77.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|