C21H21BrN3OS+ — CID 176523750
4-(4-bromophenyl)-6-cyclopropyl-6-hydroxy-3-(iminomethylidene)-5-(4-methylpyridin-1-ium-1-yl)piperidine-2-thione (PubChem CID 176523750) has the molecular formula C21H21BrN3OS+ and a molecular weight of 443.39 g/mol. Its IUPAC name is 4-(4-bromophenyl)-6-cyclopropyl-6-hydroxy-3-(iminomethylidene)-5-(4-methylpyridin-1-ium-1-yl)piperidine-2-thione.
| Compound Name | 4-(4-bromophenyl)-6-cyclopropyl-6-hydroxy-3-(iminomethylidene)-5-(4-methylpyridin-1-ium-1-yl)piperidine-2-thione |
|---|---|
| PubChem CID | 176523750 |
| Molecular Formula | C21H21BrN3OS+ |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 4-(4-bromophenyl)-6-cyclopropyl-6-hydroxy-3-(iminomethylidene)-5-(4-methylpyridin-1-ium-1-yl)piperidine-2-thione |
| SMILES | Cc1cc[n+](C2C(c3ccc(Br)cc3)C(=C=N)C(=S)NC2(O)C2CC2)cc1 |
| InChI | InChI=1S/C21H20BrN3OS/c1-13-8-10-25(11-9-13)19-18(14-2-6-16(22)7-3-14)17(12-23)20(27)24-21(19,26)15-4-5-15/h2-3,6-11,15,18-19,23,26H,4-5H2,1H3/p+1 |
| InChIKey | RTVIKQHPHQVFQZ-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 59.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|