C18H17FN3OS+ — CID 176539886
4-(2-fluorophenyl)-6-hydroxy-3-(iminomethylidene)-6-methyl-5-pyridin-1-ium-1-ylpiperidine-2-thione (PubChem CID 176539886) has the molecular formula C18H17FN3OS+ and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-6-hydroxy-3-(iminomethylidene)-6-methyl-5-pyridin-1-ium-1-ylpiperidine-2-thione.
| Compound Name | 4-(2-fluorophenyl)-6-hydroxy-3-(iminomethylidene)-6-methyl-5-pyridin-1-ium-1-ylpiperidine-2-thione |
|---|---|
| PubChem CID | 176539886 |
| Molecular Formula | C18H17FN3OS+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 4-(2-fluorophenyl)-6-hydroxy-3-(iminomethylidene)-6-methyl-5-pyridin-1-ium-1-ylpiperidine-2-thione |
| SMILES | CC1(O)NC(=S)C(=C=N)C(c2ccccc2F)C1[n+]1ccccc1 |
| InChI | InChI=1S/C18H16FN3OS/c1-18(23)16(22-9-5-2-6-10-22)15(13(11-20)17(24)21-18)12-7-3-4-8-14(12)19/h2-10,15-16,20,23H,1H3/p+1 |
| InChIKey | VCDFWMGFTMAOCV-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 59.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|