C17H13FN3S2+ — CID 15110959
(3R,4S)-4-(4-fluorophenyl)-3-pyridin-1-ium-1-yl-6-sulfanyl-2-sulfanylidene-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 15110959) has the molecular formula C17H13FN3S2+ and a molecular weight of 342.44 g/mol. Its IUPAC name is (3R,4S)-4-(4-fluorophenyl)-3-pyridin-1-ium-1-yl-6-sulfanyl-2-sulfanylidene-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | (3R,4S)-4-(4-fluorophenyl)-3-pyridin-1-ium-1-yl-6-sulfanyl-2-sulfanylidene-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 15110959 |
| Molecular Formula | C17H13FN3S2+ |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (3R,4S)-4-(4-fluorophenyl)-3-pyridin-1-ium-1-yl-6-sulfanyl-2-sulfanylidene-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | N#CC1=C(S)NC(=S)[C@H]([n+]2ccccc2)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H12FN3S2/c18-12-6-4-11(5-7-12)14-13(10-19)16(22)20-17(23)15(14)21-8-2-1-3-9-21/h1-9,14-15H,(H-,20,22,23)/p+1/t14-,15+/m0/s1 |
| InChIKey | TZQOMGDUKXLKSP-LSDHHAIUSA-O |
| XLogP | 3.03 |
| TPSA | 39.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|