C18H13F3N3OS+ — CID 6321506
(3S,4R)-2-oxo-3-pyridin-1-ium-1-yl-6-sulfanyl-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 6321506) has the molecular formula C18H13F3N3OS+ and a molecular weight of 376.38 g/mol. Its IUPAC name is (3S,4R)-2-oxo-3-pyridin-1-ium-1-yl-6-sulfanyl-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | (3S,4R)-2-oxo-3-pyridin-1-ium-1-yl-6-sulfanyl-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 6321506 |
| Molecular Formula | C18H13F3N3OS+ |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | (3S,4R)-2-oxo-3-pyridin-1-ium-1-yl-6-sulfanyl-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | N#CC1=C(S)NC(=O)[C@@H]([n+]2ccccc2)[C@@H]1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H12F3N3OS/c19-18(20,21)13-7-3-2-6-11(13)14-12(10-22)17(26)23-16(25)15(14)24-8-4-1-5-9-24/h1-9,14-15H,(H-,23,25,26)/p+1/t14-,15+/m1/s1 |
| InChIKey | YDQDETNCOHNREE-CABCVRRESA-O |
| XLogP | 3.11 |
| TPSA | 56.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|