C18H16N3O3+ — CID 54693740
4-hydroxy-2-(4-methoxyphenyl)-6-oxo-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 54693740) has the molecular formula C18H16N3O3+ and a molecular weight of 322.34 g/mol. Its IUPAC name is 4-hydroxy-2-(4-methoxyphenyl)-6-oxo-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | 4-hydroxy-2-(4-methoxyphenyl)-6-oxo-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 54693740 |
| Molecular Formula | C18H16N3O3+ |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-hydroxy-2-(4-methoxyphenyl)-6-oxo-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | COc1ccc(C2NC(=O)C(C#N)=C(O)C2[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N3O3/c1-24-13-7-5-12(6-8-13)15-16(21-9-3-2-4-10-21)17(22)14(11-19)18(23)20-15/h2-10,15-16H,1H3,(H-,20,22,23)/p+1 |
| InChIKey | NOSCDHCKNVHARE-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|