C18H16N3O3+ — CID 176520740
(5R,6R)-3-(iminomethylidene)-6-(4-methoxyphenyl)-5-pyridin-1-ium-1-ylpiperidine-2,4-dione (PubChem CID 176520740) has the molecular formula C18H16N3O3+ and a molecular weight of 322.34 g/mol. Its IUPAC name is (5R,6R)-3-(iminomethylidene)-6-(4-methoxyphenyl)-5-pyridin-1-ium-1-ylpiperidine-2,4-dione.
| Compound Name | (5R,6R)-3-(iminomethylidene)-6-(4-methoxyphenyl)-5-pyridin-1-ium-1-ylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 176520740 |
| Molecular Formula | C18H16N3O3+ |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (5R,6R)-3-(iminomethylidene)-6-(4-methoxyphenyl)-5-pyridin-1-ium-1-ylpiperidine-2,4-dione |
| SMILES | COc1ccc([C@H]2NC(=O)C(=C=N)C(=O)[C@@H]2[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N3O3/c1-24-13-7-5-12(6-8-13)15-16(21-9-3-2-4-10-21)17(22)14(11-19)18(23)20-15/h2-10,15-16,19H,1H3/p+1/t15-,16-/m1/s1 |
| InChIKey | GDAUALSBLFCRGK-HZPDHXFCSA-O |
| XLogP | 1.14 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|