C11H6Cl2F2N2O — CID 118813907
2-(3,4-dichlorophenyl)-5-(difluoromethoxy)pyrimidine (PubChem CID 118813907) has the molecular formula C11H6Cl2F2N2O and a molecular weight of 291.08 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-5-(difluoromethoxy)pyrimidine.
| Compound Name | 2-(3,4-dichlorophenyl)-5-(difluoromethoxy)pyrimidine |
|---|---|
| PubChem CID | 118813907 |
| Molecular Formula | C11H6Cl2F2N2O |
| Molecular Weight | 291.08 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-5-(difluoromethoxy)pyrimidine |
| SMILES | FC(F)Oc1cnc(-c2ccc(Cl)c(Cl)c2)nc1 |
| InChI | InChI=1S/C11H6Cl2F2N2O/c12-8-2-1-6(3-9(8)13)10-16-4-7(5-17-10)18-11(14)15/h1-5,11H |
| InChIKey | UCEYZTLZHPPCTK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.08 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |