C19H16N2O2 — CID 11881703
2-[(1S,2R,6R,7R)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile (PubChem CID 11881703) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[(1S,2R,6R,7R)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile.
| Compound Name | 2-[(1S,2R,6R,7R)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile |
|---|---|
| PubChem CID | 11881703 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[(1S,2R,6R,7R)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile |
| SMILES | CC(C)=C1[C@H]2C=C[C@@H]1[C@H]1C(=O)N(c3ccccc3C#N)C(=O)[C@@H]12 |
| InChI | InChI=1S/C19H16N2O2/c1-10(2)15-12-7-8-13(15)17-16(12)18(22)21(19(17)23)14-6-4-3-5-11(14)9-20/h3-8,12-13,16-17H,1-2H3/t12-,13+,16-,17-/m1/s1 |
| InChIKey | IQRRMJBELVGXQL-DLTLXFJOSA-N |
| XLogP | 2.82 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|