C12H14BrF3O2 — CID 118818980
1-(3-bromopropyl)-3-ethoxy-2-(trifluoromethoxy)benzene (PubChem CID 118818980) has the molecular formula C12H14BrF3O2 and a molecular weight of 327.14 g/mol. Its IUPAC name is 1-(3-bromopropyl)-3-ethoxy-2-(trifluoromethoxy)benzene.
| Compound Name | 1-(3-bromopropyl)-3-ethoxy-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 118818980 |
| Molecular Formula | C12H14BrF3O2 |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 1-(3-bromopropyl)-3-ethoxy-2-(trifluoromethoxy)benzene |
| SMILES | CCOc1cccc(CCCBr)c1OC(F)(F)F |
| InChI | InChI=1S/C12H14BrF3O2/c1-2-17-10-7-3-5-9(6-4-8-13)11(10)18-12(14,15)16/h3,5,7H,2,4,6,8H2,1H3 |
| InChIKey | HPFLWGPBFPCOFA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|