C11H13BrF2O2 — CID 118842066
1-(3-bromopropyl)-3-(difluoromethoxy)-2-methoxybenzene (PubChem CID 118842066) has the molecular formula C11H13BrF2O2 and a molecular weight of 295.12 g/mol. Its IUPAC name is 1-(3-bromopropyl)-3-(difluoromethoxy)-2-methoxybenzene.
| Compound Name | 1-(3-bromopropyl)-3-(difluoromethoxy)-2-methoxybenzene |
|---|---|
| PubChem CID | 118842066 |
| Molecular Formula | C11H13BrF2O2 |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 1-(3-bromopropyl)-3-(difluoromethoxy)-2-methoxybenzene |
| SMILES | COc1c(CCCBr)cccc1OC(F)F |
| InChI | InChI=1S/C11H13BrF2O2/c1-15-10-8(5-3-7-12)4-2-6-9(10)16-11(13)14/h2,4,6,11H,3,5,7H2,1H3 |
| InChIKey | QJGGJBSYASQLST-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|