C12H8N2O3 — CID 118820251
(E)-3-[2-(cyanomethyl)-1,3-benzoxazol-5-yl]prop-2-enoic acid (PubChem CID 118820251) has the molecular formula C12H8N2O3 and a molecular weight of 228.21 g/mol. Its IUPAC name is (E)-3-[2-(cyanomethyl)-1,3-benzoxazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(cyanomethyl)-1,3-benzoxazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118820251 |
| Molecular Formula | C12H8N2O3 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | (E)-3-[2-(cyanomethyl)-1,3-benzoxazol-5-yl]prop-2-enoic acid |
| SMILES | N#CCc1nc2cc(/C=C/C(=O)O)ccc2o1 |
| InChI | InChI=1S/C12H8N2O3/c13-6-5-11-14-9-7-8(2-4-12(15)16)1-3-10(9)17-11/h1-4,7H,5H2,(H,15,16)/b4-2+ |
| InChIKey | OAUVZCDZVNMIRG-DUXPYHPUSA-N |
| XLogP | 1.99 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|