C8H8F2N2O2 — CID 118826495
2-(difluoromethyl)-5-hydroxy-4-methylpyridine-3-carboxamide (PubChem CID 118826495) has the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-hydroxy-4-methylpyridine-3-carboxamide.
| Compound Name | 2-(difluoromethyl)-5-hydroxy-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 118826495 |
| Molecular Formula | C8H8F2N2O2 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-(difluoromethyl)-5-hydroxy-4-methylpyridine-3-carboxamide |
| SMILES | Cc1c(O)cnc(C(F)F)c1C(N)=O |
| InChI | InChI=1S/C8H8F2N2O2/c1-3-4(13)2-12-6(7(9)10)5(3)8(11)14/h2,7,13H,1H3,(H2,11,14) |
| InChIKey | FHTDWKOPDMSOOO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |