C11H5Cl3N2O2 — CID 118830549
2-(2,4,6-trichlorophenyl)pyrimidine-5-carboxylic acid (PubChem CID 118830549) has the molecular formula C11H5Cl3N2O2 and a molecular weight of 303.53 g/mol. Its IUPAC name is 2-(2,4,6-trichlorophenyl)pyrimidine-5-carboxylic acid.
| Compound Name | 2-(2,4,6-trichlorophenyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 118830549 |
| Molecular Formula | C11H5Cl3N2O2 |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 301.94 |
| IUPAC Name | 2-(2,4,6-trichlorophenyl)pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(-c2c(Cl)cc(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C11H5Cl3N2O2/c12-6-1-7(13)9(8(14)2-6)10-15-3-5(4-16-10)11(17)18/h1-4H,(H,17,18) |
| InChIKey | FTOCRSHVOHEHCB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |