C9H9F3N2O2 — CID 118836900
2-[2-(aminomethyl)-5-(difluoromethyl)-6-fluoro-3-pyridinyl]acetic acid (PubChem CID 118836900) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-5-(difluoromethyl)-6-fluoro-3-pyridinyl]acetic acid.
| Compound Name | 2-[2-(aminomethyl)-5-(difluoromethyl)-6-fluoro-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118836900 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-[2-(aminomethyl)-5-(difluoromethyl)-6-fluoro-3-pyridinyl]acetic acid |
| SMILES | NCc1nc(F)c(C(F)F)cc1CC(=O)O |
| InChI | InChI=1S/C9H9F3N2O2/c10-8(11)5-1-4(2-7(15)16)6(3-13)14-9(5)12/h1,8H,2-3,13H2,(H,15,16) |
| InChIKey | YHVDTYQVILESFV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|