C8H5F4NO2 — CID 119000090
2-[5-(difluoromethyl)-2,6-difluoro-3-pyridinyl]acetic acid (PubChem CID 119000090) has the molecular formula C8H5F4NO2 and a molecular weight of 223.12 g/mol. Its IUPAC name is 2-[5-(difluoromethyl)-2,6-difluoro-3-pyridinyl]acetic acid.
| Compound Name | 2-[5-(difluoromethyl)-2,6-difluoro-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 119000090 |
| Molecular Formula | C8H5F4NO2 |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-[5-(difluoromethyl)-2,6-difluoro-3-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(C(F)F)c(F)nc1F |
| InChI | InChI=1S/C8H5F4NO2/c9-6(10)4-1-3(2-5(14)15)7(11)13-8(4)12/h1,6H,2H2,(H,14,15) |
| InChIKey | PDCVEOJEEUWWOX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|