C8H6F3NO2 — CID 130096522
2-[5-(difluoromethyl)-6-fluoro-3-pyridinyl]acetic acid (PubChem CID 130096522) has the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. Its IUPAC name is 2-[5-(difluoromethyl)-6-fluoro-3-pyridinyl]acetic acid.
| Compound Name | 2-[5-(difluoromethyl)-6-fluoro-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 130096522 |
| Molecular Formula | C8H6F3NO2 |
| Molecular Weight | 205.13 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 2-[5-(difluoromethyl)-6-fluoro-3-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cnc(F)c(C(F)F)c1 |
| InChI | InChI=1S/C8H6F3NO2/c9-7(10)5-1-4(2-6(13)14)3-12-8(5)11/h1,3,7H,2H2,(H,13,14) |
| InChIKey | GCWHTAFOPSVGRG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.13 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|