C14H11Cl4N — CID 118840486
2-[5-chloro-2-(2,3,4-trichlorophenyl)phenyl]ethanamine (PubChem CID 118840486) has the molecular formula C14H11Cl4N and a molecular weight of 335.06 g/mol. Its IUPAC name is 2-[5-chloro-2-(2,3,4-trichlorophenyl)phenyl]ethanamine.
| Compound Name | 2-[5-chloro-2-(2,3,4-trichlorophenyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 118840486 |
| Molecular Formula | C14H11Cl4N |
| Molecular Weight | 335.06 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 2-[5-chloro-2-(2,3,4-trichlorophenyl)phenyl]ethanamine |
| SMILES | NCCc1cc(Cl)ccc1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H11Cl4N/c15-9-1-2-10(8(7-9)5-6-19)11-3-4-12(16)14(18)13(11)17/h1-4,7H,5-6,19H2 |
| InChIKey | KETHSQVOIZGTAQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.06 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|