C24H40N2O6 — CID 11884728
[(1R,2R,4aR,5S,6R,8aS)-6-hydroxy-1-(hydroxymethyl)-5-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-prop-2-enylcarbamate (PubChem CID 11884728) has the molecular formula C24H40N2O6 and a molecular weight of 452.59 g/mol. Its IUPAC name is [(1R,2R,4aR,5S,6R,8aS)-6-hydroxy-1-(hydroxymethyl)-5-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-prop-2-enylcarbamate.
| Compound Name | [(1R,2R,4aR,5S,6R,8aS)-6-hydroxy-1-(hydroxymethyl)-5-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 11884728 |
| Molecular Formula | C24H40N2O6 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | [(1R,2R,4aR,5S,6R,8aS)-6-hydroxy-1-(hydroxymethyl)-5-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-prop-2-enylcarbamate |
| SMILES | C=CCNC(=O)O[C@@H]1CC[C@]2(C)[C@H](CC[C@@H](O)[C@H]2CC(=O)N2CCC[C@H]2CO)[C@]1(C)CO |
| InChI | InChI=1S/C24H40N2O6/c1-4-11-25-22(31)32-20-9-10-23(2)17(13-21(30)26-12-5-6-16(26)14-27)18(29)7-8-19(23)24(20,3)15-28/h4,16-20,27-29H,1,5-15H2,2-3H3,(H,25,31)/t16-,17+,18+,19-,20+,23-,24-/m0/s1 |
| InChIKey | IZXBXUGCVVZDDQ-FGXQUKBJSA-N |
| XLogP | 1.83 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|