C9H9F2NO3 — CID 118848622
6-(difluoromethyl)-4,5-dimethoxypyridine-2-carbaldehyde (PubChem CID 118848622) has the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. Its IUPAC name is 6-(difluoromethyl)-4,5-dimethoxypyridine-2-carbaldehyde.
| Compound Name | 6-(difluoromethyl)-4,5-dimethoxypyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 118848622 |
| Molecular Formula | C9H9F2NO3 |
| Molecular Weight | 217.17 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 6-(difluoromethyl)-4,5-dimethoxypyridine-2-carbaldehyde |
| SMILES | COc1cc(C=O)nc(C(F)F)c1OC |
| InChI | InChI=1S/C9H9F2NO3/c1-14-6-3-5(4-13)12-7(9(10)11)8(6)15-2/h3-4,9H,1-2H3 |
| InChIKey | ZGBSMBIVIZIXDH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|