C12H11NO3 — CID 23125776
4,8-dimethoxyquinoline-2-carbaldehyde (PubChem CID 23125776) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 4,8-dimethoxyquinoline-2-carbaldehyde.
| Compound Name | 4,8-dimethoxyquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 23125776 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 4,8-dimethoxyquinoline-2-carbaldehyde |
| SMILES | COc1cc(C=O)nc2c(OC)cccc12 |
| InChI | InChI=1S/C12H11NO3/c1-15-10-5-3-4-9-11(16-2)6-8(7-14)13-12(9)10/h3-7H,1-2H3 |
| InChIKey | SAKWCCJMIRLRLP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|