About CID 21351085
CID 21351085 (PubChem CID 21351085) has the molecular formula C22H20Al2N2O5
and a molecular weight of 446.38 g/mol.
Molecular Properties
| Compound Name | CID 21351085 |
| PubChem CID | 21351085 |
| Molecular Formula | C22H20Al2N2O5 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | — |
| SMILES | COc1cc(C)nc2c(O[Al]O[Al]Oc3cccc4c(OC)cc(C)nc34)cccc12 |
| InChI | InChI=1S/2C11H11NO2.2Al.O/c2*1-7-6-10(14-2)8-4-3-5-9(13)11(8)12-7;;;/h2*3-6,13H,1-2H3;;;/q;;2*+1;/p-2 |
| InChIKey | AKKNULJZUUIEGP-UHFFFAOYSA-L |
| XLogP | 3.96 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 21351085 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21351085?
The IUPAC name of CID 21351085 (CID 21351085) is not available.
What is the SMILES notation for CID 21351085?
The canonical SMILES for CID 21351085 is COc1cc(C)nc2c(O[Al]O[Al]Oc3cccc4c(OC)cc(C)nc34)cccc12.
What is the InChIKey of CID 21351085?
The InChIKey is AKKNULJZUUIEGP-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H11NO2.2Al.O/c2*1-7-6-10(14-2)8-4-3-5-9(13)11(8)12-7;;;/h2*3-6,13H,1-2H3;;;/q;;2*+1;/p-2.
What are the key properties of CID 21351085?
CID 21351085 has a molecular weight of 446.38 g/mol, XLogP of 3.96, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21351085 is sourced from PubChem (CID 21351085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).