C8H8F2INO2 — CID 118842846
2-(difluoromethyl)-6-iodo-3,4-dimethoxypyridine (PubChem CID 118842846) has the molecular formula C8H8F2INO2 and a molecular weight of 315.06 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-iodo-3,4-dimethoxypyridine.
| Compound Name | 2-(difluoromethyl)-6-iodo-3,4-dimethoxypyridine |
|---|---|
| PubChem CID | 118842846 |
| Molecular Formula | C8H8F2INO2 |
| Molecular Weight | 315.06 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 2-(difluoromethyl)-6-iodo-3,4-dimethoxypyridine |
| SMILES | COc1cc(I)nc(C(F)F)c1OC |
| InChI | InChI=1S/C8H8F2INO2/c1-13-4-3-5(11)12-6(8(9)10)7(4)14-2/h3,8H,1-2H3 |
| InChIKey | BTRFQYBUIZZJRE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.06 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|