C8H9F2IN2O — CID 130085511
[6-(difluoromethyl)-4-iodo-5-methoxy-2-pyridinyl]methanamine (PubChem CID 130085511) has the molecular formula C8H9F2IN2O and a molecular weight of 314.07 g/mol. Its IUPAC name is [6-(difluoromethyl)-4-iodo-5-methoxy-2-pyridinyl]methanamine.
| Compound Name | [6-(difluoromethyl)-4-iodo-5-methoxy-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 130085511 |
| Molecular Formula | C8H9F2IN2O |
| Molecular Weight | 314.07 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | [6-(difluoromethyl)-4-iodo-5-methoxy-2-pyridinyl]methanamine |
| SMILES | COc1c(I)cc(CN)nc1C(F)F |
| InChI | InChI=1S/C8H9F2IN2O/c1-14-7-5(11)2-4(3-12)13-6(7)8(9)10/h2,8H,3,12H2,1H3 |
| InChIKey | NWJBJOKBYLDPHM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.07 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|