C16H19N3O4 — CID 118858088
2-[2-(8-ethyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl)-2-oxoethoxy]acetic acid (PubChem CID 118858088) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-[2-(8-ethyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl)-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-(8-ethyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl)-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 118858088 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-[2-(8-ethyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl)-2-oxoethoxy]acetic acid |
| SMILES | CCn1c2c(c3cccnc31)CCN(C(=O)COCC(=O)O)C2 |
| InChI | InChI=1S/C16H19N3O4/c1-2-19-13-8-18(14(20)9-23-10-15(21)22)7-5-11(13)12-4-3-6-17-16(12)19/h3-4,6H,2,5,7-10H2,1H3,(H,21,22) |
| InChIKey | CIZQQNRZCMMXKU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |