C20H28O7P2 — CID 118859901
[4-[4-[hydroxy(2-methylpropoxy)phosphoryl]phenoxy]phenyl]-(2-methylpropoxy)phosphinic acid (PubChem CID 118859901) has the molecular formula C20H28O7P2 and a molecular weight of 442.39 g/mol. Its IUPAC name is [4-[4-[hydroxy(2-methylpropoxy)phosphoryl]phenoxy]phenyl]-(2-methylpropoxy)phosphinic acid.
| Compound Name | [4-[4-[hydroxy(2-methylpropoxy)phosphoryl]phenoxy]phenyl]-(2-methylpropoxy)phosphinic acid |
|---|---|
| PubChem CID | 118859901 |
| Molecular Formula | C20H28O7P2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | [4-[4-[hydroxy(2-methylpropoxy)phosphoryl]phenoxy]phenyl]-(2-methylpropoxy)phosphinic acid |
| SMILES | CC(C)COP(=O)(O)c1ccc(Oc2ccc(P(=O)(O)OCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H28O7P2/c1-15(2)13-25-28(21,22)19-9-5-17(6-10-19)27-18-7-11-20(12-8-18)29(23,24)26-14-16(3)4/h5-12,15-16H,13-14H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | NKVYVKFACVUYJQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|