C22H39O4P — CID 154167603
bis(2-methylpropyl) [4-(2,4,4-trimethylpentan-2-yl)phenyl] phosphate (PubChem CID 154167603) has the molecular formula C22H39O4P and a molecular weight of 398.52 g/mol. Its IUPAC name is bis(2-methylpropyl) [4-(2,4,4-trimethylpentan-2-yl)phenyl] phosphate.
| Compound Name | bis(2-methylpropyl) [4-(2,4,4-trimethylpentan-2-yl)phenyl] phosphate |
|---|---|
| PubChem CID | 154167603 |
| Molecular Formula | C22H39O4P |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | bis(2-methylpropyl) [4-(2,4,4-trimethylpentan-2-yl)phenyl] phosphate |
| SMILES | CC(C)COP(=O)(OCC(C)C)Oc1ccc(C(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H39O4P/c1-17(2)14-24-27(23,25-15-18(3)4)26-20-12-10-19(11-13-20)22(8,9)16-21(5,6)7/h10-13,17-18H,14-16H2,1-9H3 |
| InChIKey | IOSLCKOEHMAZJM-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|