C27H31F2N4O9P — CID 118860333
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[4-(5-fluoro-2-pyridinyl)phenoxy]phosphoryl]amino]propanoate (PubChem CID 118860333) has the molecular formula C27H31F2N4O9P and a molecular weight of 624.53 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[4-(5-fluoro-2-pyridinyl)phenoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[4-(5-fluoro-2-pyridinyl)phenoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118860333 |
| Molecular Formula | C27H31F2N4O9P |
| Molecular Weight | 624.53 g/mol |
| Exact Mass | 624.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[4-(5-fluoro-2-pyridinyl)phenoxy]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)Oc1ccc(-c2ccc(F)cn2)cc1 |
| InChI | InChI=1S/C27H31F2N4O9P/c1-15(2)40-24(36)16(3)32-43(38,42-19-8-5-17(6-9-19)20-10-7-18(28)13-30-20)39-14-21-23(35)27(4,29)25(41-21)33-12-11-22(34)31-26(33)37/h5-13,15-16,21,23,25,35H,14H2,1-4H3,(H,32,38)(H,31,34,37)/t16-,21+,23+,25+,27+,43?/m0/s1 |
| InChIKey | BIRZKNCAMNGRBF-XITSNYBHSA-N |
| XLogP | 2.86 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|