C25H29N5O2S — CID 118862498
2-[[2-(1-methylpiperidin-4-yl)oxy-3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methyl]-1,3-benzothiazole (PubChem CID 118862498) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is 2-[[2-(1-methylpiperidin-4-yl)oxy-3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methyl]-1,3-benzothiazole.
| Compound Name | 2-[[2-(1-methylpiperidin-4-yl)oxy-3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 118862498 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-[[2-(1-methylpiperidin-4-yl)oxy-3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]methyl]-1,3-benzothiazole |
| SMILES | CN1CCC(Oc2c(Cc3nc4ccccc4s3)cccc2OCCCn2cncn2)CC1 |
| InChI | InChI=1S/C25H29N5O2S/c1-29-13-10-20(11-14-29)32-25-19(16-24-28-21-7-2-3-9-23(21)33-24)6-4-8-22(25)31-15-5-12-30-18-26-17-27-30/h2-4,6-9,17-18,20H,5,10-16H2,1H3 |
| InChIKey | REVDXOUBWYEZKI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|