C16H24N4O4 — CID 11886368
(7S,9aR)-2-(1-acetylpiperidine-4-carbonyl)-7-methyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 11886368) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is (7S,9aR)-2-(1-acetylpiperidine-4-carbonyl)-7-methyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-2-(1-acetylpiperidine-4-carbonyl)-7-methyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 11886368 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (7S,9aR)-2-(1-acetylpiperidine-4-carbonyl)-7-methyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CC(=O)N1CCC(C(=O)N2CCN3C(=O)[C@H](C)NC(=O)[C@H]3C2)CC1 |
| InChI | InChI=1S/C16H24N4O4/c1-10-15(23)20-8-7-19(9-13(20)14(22)17-10)16(24)12-3-5-18(6-4-12)11(2)21/h10,12-13H,3-9H2,1-2H3,(H,17,22)/t10-,13+/m0/s1 |
| InChIKey | IEBTVTVUHXKGIZ-GXFFZTMASA-N |
| XLogP | -1.20 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |