C18H23NO4 — CID 118870945
1-ethenylpyrrolidin-2-one;2-methylidene-5-phenoxypentanoic acid (PubChem CID 118870945) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;2-methylidene-5-phenoxypentanoic acid.
| Compound Name | 1-ethenylpyrrolidin-2-one;2-methylidene-5-phenoxypentanoic acid |
|---|---|
| PubChem CID | 118870945 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;2-methylidene-5-phenoxypentanoic acid |
| SMILES | C=C(CCCOc1ccccc1)C(=O)O.C=CN1CCCC1=O |
| InChI | InChI=1S/C12H14O3.C6H9NO/c1-10(12(13)14)6-5-9-15-11-7-3-2-4-8-11;1-2-7-5-3-4-6(7)8/h2-4,7-8H,1,5-6,9H2,(H,13,14);2H,1,3-5H2 |
| InChIKey | TYZUIPORHUYPKL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|