C25H28FN3O3 — CID 118871106
2-tert-butyl-4-[(4-fluorophenyl)-(5-hydroxyisoquinolin-6-yl)methyl]piperazine-1-carboxylic acid (PubChem CID 118871106) has the molecular formula C25H28FN3O3 and a molecular weight of 437.52 g/mol. Its IUPAC name is 2-tert-butyl-4-[(4-fluorophenyl)-(5-hydroxyisoquinolin-6-yl)methyl]piperazine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-[(4-fluorophenyl)-(5-hydroxyisoquinolin-6-yl)methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 118871106 |
| Molecular Formula | C25H28FN3O3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 2-tert-butyl-4-[(4-fluorophenyl)-(5-hydroxyisoquinolin-6-yl)methyl]piperazine-1-carboxylic acid |
| SMILES | CC(C)(C)C1CN(C(c2ccc(F)cc2)c2ccc3cnccc3c2O)CCN1C(=O)O |
| InChI | InChI=1S/C25H28FN3O3/c1-25(2,3)21-15-28(12-13-29(21)24(31)32)22(16-4-7-18(26)8-5-16)20-9-6-17-14-27-11-10-19(17)23(20)30/h4-11,14,21-22,30H,12-13,15H2,1-3H3,(H,31,32) |
| InChIKey | AMEADCSVEUHGGJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|