C34H28F2N6O2 — CID 162672582
7-[(4-fluorophenyl)-[4-[(4-fluorophenyl)-(8-hydroxyquinazolin-7-yl)methyl]piperazin-1-yl]methyl]quinazolin-8-ol (PubChem CID 162672582) has the molecular formula C34H28F2N6O2 and a molecular weight of 590.63 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)-[4-[(4-fluorophenyl)-(8-hydroxyquinazolin-7-yl)methyl]piperazin-1-yl]methyl]quinazolin-8-ol.
| Compound Name | 7-[(4-fluorophenyl)-[4-[(4-fluorophenyl)-(8-hydroxyquinazolin-7-yl)methyl]piperazin-1-yl]methyl]quinazolin-8-ol |
|---|---|
| PubChem CID | 162672582 |
| Molecular Formula | C34H28F2N6O2 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 7-[(4-fluorophenyl)-[4-[(4-fluorophenyl)-(8-hydroxyquinazolin-7-yl)methyl]piperazin-1-yl]methyl]quinazolin-8-ol |
| SMILES | Oc1c(C(c2ccc(F)cc2)N2CCN(C(c3ccc(F)cc3)c3ccc4cncnc4c3O)CC2)ccc2cncnc12 |
| InChI | InChI=1S/C34H28F2N6O2/c35-25-7-1-21(2-8-25)31(27-11-5-23-17-37-19-39-29(23)33(27)43)41-13-15-42(16-14-41)32(22-3-9-26(36)10-4-22)28-12-6-24-18-38-20-40-30(24)34(28)44/h1-12,17-20,31-32,43-44H,13-16H2 |
| InChIKey | RTYBHRAALOEFDW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|