C18H17NOS2 — CID 118871472
2-methyl-4-[methylsulfinyl(diphenyl)methyl]-1,3-thiazole (PubChem CID 118871472) has the molecular formula C18H17NOS2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 2-methyl-4-[methylsulfinyl(diphenyl)methyl]-1,3-thiazole.
| Compound Name | 2-methyl-4-[methylsulfinyl(diphenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 118871472 |
| Molecular Formula | C18H17NOS2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-methyl-4-[methylsulfinyl(diphenyl)methyl]-1,3-thiazole |
| SMILES | Cc1nc(C(c2ccccc2)(c2ccccc2)S(C)=O)cs1 |
| InChI | InChI=1S/C18H17NOS2/c1-14-19-17(13-21-14)18(22(2)20,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-13H,1-2H3 |
| InChIKey | RXBOQFIBGKNKIM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |