C44H50F2N6O7S2 — CID 118871777
bis[1-azabicyclo[2.2.2]octan-3-yl-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl]carbamoyl] 2-hydroxybutanedioate (PubChem CID 118871777) has the molecular formula C44H50F2N6O7S2 and a molecular weight of 877.05 g/mol. Its IUPAC name is bis[1-azabicyclo[2.2.2]octan-3-yl-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl]carbamoyl] 2-hydroxybutanedioate.
| Compound Name | bis[1-azabicyclo[2.2.2]octan-3-yl-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl]carbamoyl] 2-hydroxybutanedioate |
|---|---|
| PubChem CID | 118871777 |
| Molecular Formula | C44H50F2N6O7S2 |
| Molecular Weight | 877.05 g/mol |
| Exact Mass | 876.32 |
| IUPAC Name | bis[1-azabicyclo[2.2.2]octan-3-yl-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl]carbamoyl] 2-hydroxybutanedioate |
| SMILES | CC(C)(c1csc(-c2ccc(F)cc2)n1)N(C(=O)OC(=O)CC(O)C(=O)OC(=O)N(C1CN2CCC1CC2)C(C)(C)c1csc(-c2ccc(F)cc2)n1)C1CN2CCC1CC2 |
| InChI | InChI=1S/C44H50F2N6O7S2/c1-43(2,35-24-60-38(47-35)28-5-9-30(45)10-6-28)51(32-22-49-17-13-26(32)14-18-49)41(56)58-37(54)21-34(53)40(55)59-42(57)52(33-23-50-19-15-27(33)16-20-50)44(3,4)36-25-61-39(48-36)29-7-11-31(46)12-8-29/h5-12,24-27,32-34,53H,13-23H2,1-4H3 |
| InChIKey | KCNZAOYKZQLSGJ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.05 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|