C20H26FN3O2S — CID 161434576
(3S)-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl]-1-azabicyclo[2.2.2]octan-3-amine;formic acid (PubChem CID 161434576) has the molecular formula C20H26FN3O2S and a molecular weight of 391.51 g/mol. Its IUPAC name is (3S)-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl]-1-azabicyclo[2.2.2]octan-3-amine;formic acid.
| Compound Name | (3S)-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl]-1-azabicyclo[2.2.2]octan-3-amine;formic acid |
|---|---|
| PubChem CID | 161434576 |
| Molecular Formula | C20H26FN3O2S |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (3S)-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl]-1-azabicyclo[2.2.2]octan-3-amine;formic acid |
| SMILES | CC(C)(N[C@@H]1CN2CCC1CC2)c1csc(-c2ccc(F)cc2)n1.O=CO |
| InChI | InChI=1S/C19H24FN3S.CH2O2/c1-19(2,22-16-11-23-9-7-13(16)8-10-23)17-12-24-18(21-17)14-3-5-15(20)6-4-14;2-1-3/h3-6,12-13,16,22H,7-11H2,1-2H3;1H,(H,2,3)/t16-;/m1./s1 |
| InChIKey | VYLXUURRYHOLQE-PKLMIRHRSA-N |
| XLogP | 3.57 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|