C24H33N3O4S — CID 140681860
1-azabicyclo[3.2.2]nonan-4-yl N-[2-[2-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-4-yl]propan-2-yl]carbamate (PubChem CID 140681860) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is 1-azabicyclo[3.2.2]nonan-4-yl N-[2-[2-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-4-yl]propan-2-yl]carbamate.
| Compound Name | 1-azabicyclo[3.2.2]nonan-4-yl N-[2-[2-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-4-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 140681860 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 1-azabicyclo[3.2.2]nonan-4-yl N-[2-[2-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-4-yl]propan-2-yl]carbamate |
| SMILES | COCCOc1ccc(-c2nc(C(C)(C)NC(=O)OC3CCN4CCC3CC4)cs2)cc1 |
| InChI | InChI=1S/C24H33N3O4S/c1-24(2,26-23(28)31-20-10-13-27-11-8-17(20)9-12-27)21-16-32-22(25-21)18-4-6-19(7-5-18)30-15-14-29-3/h4-7,16-17,20H,8-15H2,1-3H3,(H,26,28) |
| InChIKey | CEROKRDOULFXPC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|