C21H15F2NOS — CID 118879928
2-[3-[4-(1,1-difluoroethyl)phenyl]phenyl]-1,2-benzothiazol-3-one (PubChem CID 118879928) has the molecular formula C21H15F2NOS and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-[3-[4-(1,1-difluoroethyl)phenyl]phenyl]-1,2-benzothiazol-3-one.
| Compound Name | 2-[3-[4-(1,1-difluoroethyl)phenyl]phenyl]-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 118879928 |
| Molecular Formula | C21H15F2NOS |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2-[3-[4-(1,1-difluoroethyl)phenyl]phenyl]-1,2-benzothiazol-3-one |
| SMILES | CC(F)(F)c1ccc(-c2cccc(-n3sc4ccccc4c3=O)c2)cc1 |
| InChI | InChI=1S/C21H15F2NOS/c1-21(22,23)16-11-9-14(10-12-16)15-5-4-6-17(13-15)24-20(25)18-7-2-3-8-19(18)26-24/h2-13H,1H3 |
| InChIKey | JENFFAKPYLJCTO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |