C29H34F2N5O8P — CID 118880230
propan-2-yl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methylpurin-9-yl)-2,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 118880230) has the molecular formula C29H34F2N5O8P and a molecular weight of 649.59 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methylpurin-9-yl)-2,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methylpurin-9-yl)-2,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118880230 |
| Molecular Formula | C29H34F2N5O8P |
| Molecular Weight | 649.59 g/mol |
| Exact Mass | 649.21 |
| IUPAC Name | propan-2-yl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methylpurin-9-yl)-2,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(C)nc2c1ncn2[C@@H]1O[C@](F)(COP(=O)(NC(C)C(=O)OC(C)C)Oc2cccc3ccccc23)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C29H34F2N5O8P/c1-6-40-26-23-25(33-18(5)34-26)36(15-32-23)27-22(30)24(37)29(31,43-27)14-41-45(39,35-17(4)28(38)42-16(2)3)44-21-13-9-11-19-10-7-8-12-20(19)21/h7-13,15-17,22,24,27,37H,6,14H2,1-5H3,(H,35,39)/t17?,22-,24+,27-,29-,45?/m1/s1 |
| InChIKey | IBYFJNIGFGBPLG-GNJBYUPHSA-N |
| XLogP | 4.71 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|