C15H22N2O2 — CID 118880559
1-butyl-5-(2-nitropropyl)-2,3-dihydroindole (PubChem CID 118880559) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-butyl-5-(2-nitropropyl)-2,3-dihydroindole.
| Compound Name | 1-butyl-5-(2-nitropropyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 118880559 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-butyl-5-(2-nitropropyl)-2,3-dihydroindole |
| SMILES | CCCCN1CCc2cc(CC(C)[N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C15H22N2O2/c1-3-4-8-16-9-7-14-11-13(5-6-15(14)16)10-12(2)17(18)19/h5-6,11-12H,3-4,7-10H2,1-2H3 |
| InChIKey | SHLFMIXFQQHQHL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|