C23H32N2O4 — CID 144749210
ethane;formic acid;5-(2-nitropropyl)-1-(3-phenylpropyl)-2,3-dihydroindole (PubChem CID 144749210) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is ethane;formic acid;5-(2-nitropropyl)-1-(3-phenylpropyl)-2,3-dihydroindole.
| Compound Name | ethane;formic acid;5-(2-nitropropyl)-1-(3-phenylpropyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 144749210 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | ethane;formic acid;5-(2-nitropropyl)-1-(3-phenylpropyl)-2,3-dihydroindole |
| SMILES | CC.CC(Cc1ccc2c(c1)CCN2CCCc1ccccc1)[N+](=O)[O-].O=CO |
| InChI | InChI=1S/C20H24N2O2.C2H6.CH2O2/c1-16(22(23)24)14-18-9-10-20-19(15-18)11-13-21(20)12-5-8-17-6-3-2-4-7-17;1-2;2-1-3/h2-4,6-7,9-10,15-16H,5,8,11-14H2,1H3;1-2H3;1H,(H,2,3) |
| InChIKey | RGCIFHWTBWWFMW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|