C26H43N9O6 — CID 118885415
(2S)-N-[(2S)-4-amino-1-[[(3S)-6-(diaminomethylamino)-2-oxohexan-3-yl]amino]-1,4-dioxobutan-2-yl]-2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]pentanediamide (PubChem CID 118885415) has the molecular formula C26H43N9O6 and a molecular weight of 577.69 g/mol. Its IUPAC name is (2S)-N-[(2S)-4-amino-1-[[(3S)-6-(diaminomethylamino)-2-oxohexan-3-yl]amino]-1,4-dioxobutan-2-yl]-2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]pentanediamide.
| Compound Name | (2S)-N-[(2S)-4-amino-1-[[(3S)-6-(diaminomethylamino)-2-oxohexan-3-yl]amino]-1,4-dioxobutan-2-yl]-2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]pentanediamide |
|---|---|
| PubChem CID | 118885415 |
| Molecular Formula | C26H43N9O6 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.33 |
| IUPAC Name | (2S)-N-[(2S)-4-amino-1-[[(3S)-6-(diaminomethylamino)-2-oxohexan-3-yl]amino]-1,4-dioxobutan-2-yl]-2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]pentanediamide |
| SMILES | CN[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCNC(N)N)C(C)=O |
| InChI | InChI=1S/C26H43N9O6/c1-15(36)17(9-6-12-32-26(29)30)33-25(41)20(14-22(28)38)35-23(39)18(10-11-21(27)37)34-24(40)19(31-2)13-16-7-4-3-5-8-16/h3-5,7-8,17-20,26,31-32H,6,9-14,29-30H2,1-2H3,(H2,27,37)(H2,28,38)(H,33,41)(H,34,40)(H,35,39)/t17-,18-,19-,20-/m0/s1 |
| InChIKey | MLVGERGNTYKDPL-MUGJNUQGSA-N |
| XLogP | -3.43 |
| TPSA | 266.65 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|