C13H11FN2OS — CID 118886762
2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl cyanate (PubChem CID 118886762) has the molecular formula C13H11FN2OS and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl cyanate.
| Compound Name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl cyanate |
|---|---|
| PubChem CID | 118886762 |
| Molecular Formula | C13H11FN2OS |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl cyanate |
| SMILES | CC(C)(OC#N)c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C13H11FN2OS/c1-13(2,17-8-15)11-7-18-12(16-11)9-3-5-10(14)6-4-9/h3-7H,1-2H3 |
| InChIKey | CKRCKUJRXGTYQA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|